C23H15Cl2N3O5 — CID 4917474
2-(1,3-benzodioxol-5-yl)-9-chloro-5-(2-chloro-5-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 4917474) has the molecular formula C23H15Cl2N3O5 and a molecular weight of 484.30 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-9-chloro-5-(2-chloro-5-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-9-chloro-5-(2-chloro-5-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 4917474 |
| Molecular Formula | C23H15Cl2N3O5 |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-9-chloro-5-(2-chloro-5-nitrophenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(C2Oc3ccc(Cl)cc3C3CC(c4ccc5c(c4)OCO5)=NN32)c1 |
| InChI | InChI=1S/C23H15Cl2N3O5/c24-13-2-6-20-16(8-13)19-10-18(12-1-5-21-22(7-12)32-11-31-21)26-27(19)23(33-20)15-9-14(28(29)30)3-4-17(15)25/h1-9,19,23H,10-11H2 |
| InChIKey | CFHCJBNUSCKKNS-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|