C23H27NO5 — CID 4917671
3-(4-cyclopentyloxyphenyl)-3-(2-phenoxypropanoylamino)propanoic acid (PubChem CID 4917671) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 3-(4-cyclopentyloxyphenyl)-3-(2-phenoxypropanoylamino)propanoic acid.
| Compound Name | 3-(4-cyclopentyloxyphenyl)-3-(2-phenoxypropanoylamino)propanoic acid |
|---|---|
| PubChem CID | 4917671 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3-(4-cyclopentyloxyphenyl)-3-(2-phenoxypropanoylamino)propanoic acid |
| SMILES | CC(Oc1ccccc1)C(=O)NC(CC(=O)O)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C23H27NO5/c1-16(28-18-7-3-2-4-8-18)23(27)24-21(15-22(25)26)17-11-13-20(14-12-17)29-19-9-5-6-10-19/h2-4,7-8,11-14,16,19,21H,5-6,9-10,15H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | OJBUUVORXOOKLB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |