C24H28NO4- — CID 7320291
(3R)-3-(4-cyclopentyloxyphenyl)-3-[[(3S)-3-phenylbutanoyl]amino]propanoate (PubChem CID 7320291) has the molecular formula C24H28NO4- and a molecular weight of 394.49 g/mol. Its IUPAC name is (3R)-3-(4-cyclopentyloxyphenyl)-3-[[(3S)-3-phenylbutanoyl]amino]propanoate.
| Compound Name | (3R)-3-(4-cyclopentyloxyphenyl)-3-[[(3S)-3-phenylbutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 7320291 |
| Molecular Formula | C24H28NO4- |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | (3R)-3-(4-cyclopentyloxyphenyl)-3-[[(3S)-3-phenylbutanoyl]amino]propanoate |
| SMILES | C[C@@H](CC(=O)N[C@H](CC(=O)[O-])c1ccc(OC2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO4/c1-17(18-7-3-2-4-8-18)15-23(26)25-22(16-24(27)28)19-11-13-21(14-12-19)29-20-9-5-6-10-20/h2-4,7-8,11-14,17,20,22H,5-6,9-10,15-16H2,1H3,(H,25,26)(H,27,28)/p-1/t17-,22+/m0/s1 |
| InChIKey | HTIMCRZFXNWJNF-HTAPYJJXSA-M |
| XLogP | 3.50 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |