C22H23N2O6- — CID 7057816
(3R)-3-(4-cyclopentyloxyphenyl)-3-[(3-methyl-2-nitrobenzoyl)amino]propanoate (PubChem CID 7057816) has the molecular formula C22H23N2O6- and a molecular weight of 411.43 g/mol. Its IUPAC name is (3R)-3-(4-cyclopentyloxyphenyl)-3-[(3-methyl-2-nitrobenzoyl)amino]propanoate.
| Compound Name | (3R)-3-(4-cyclopentyloxyphenyl)-3-[(3-methyl-2-nitrobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 7057816 |
| Molecular Formula | C22H23N2O6- |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (3R)-3-(4-cyclopentyloxyphenyl)-3-[(3-methyl-2-nitrobenzoyl)amino]propanoate |
| SMILES | Cc1cccc(C(=O)N[C@H](CC(=O)[O-])c2ccc(OC3CCCC3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H24N2O6/c1-14-5-4-8-18(21(14)24(28)29)22(27)23-19(13-20(25)26)15-9-11-17(12-10-15)30-16-6-2-3-7-16/h4-5,8-12,16,19H,2-3,6-7,13H2,1H3,(H,23,27)(H,25,26)/p-1/t19-/m1/s1 |
| InChIKey | KSPNMOPONVIHLY-LJQANCHMSA-M |
| XLogP | 2.84 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|