C15H21FN2O4 — CID 49176751
5-[2-(2-ethoxyethoxy)propanoylamino]-2-fluoro-N-methylbenzamide (PubChem CID 49176751) has the molecular formula C15H21FN2O4 and a molecular weight of 312.34 g/mol. Its IUPAC name is 5-[2-(2-ethoxyethoxy)propanoylamino]-2-fluoro-N-methylbenzamide.
| Compound Name | 5-[2-(2-ethoxyethoxy)propanoylamino]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 49176751 |
| Molecular Formula | C15H21FN2O4 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 5-[2-(2-ethoxyethoxy)propanoylamino]-2-fluoro-N-methylbenzamide |
| SMILES | CCOCCOC(C)C(=O)Nc1ccc(F)c(C(=O)NC)c1 |
| InChI | InChI=1S/C15H21FN2O4/c1-4-21-7-8-22-10(2)14(19)18-11-5-6-13(16)12(9-11)15(20)17-3/h5-6,9-10H,4,7-8H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | IAWUIIWMDPKHKS-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|