C10H12F4N2O3 — CID 4920076
5-methyl-1-[1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione (PubChem CID 4920076) has the molecular formula C10H12F4N2O3 and a molecular weight of 284.21 g/mol. Its IUPAC name is 5-methyl-1-[1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 4920076 |
| Molecular Formula | C10H12F4N2O3 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-methyl-1-[1-(2,2,3,3-tetrafluoropropoxy)ethyl]pyrimidine-2,4-dione |
| SMILES | Cc1cn(C(C)OCC(F)(F)C(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12F4N2O3/c1-5-3-16(9(18)15-7(5)17)6(2)19-4-10(13,14)8(11)12/h3,6,8H,4H2,1-2H3,(H,15,17,18) |
| InChIKey | KDKRKQHCAMXISM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|