C32H30N3O6+ — CID 4921284
4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 4921284) has the molecular formula C32H30N3O6+ and a molecular weight of 552.61 g/mol. Its IUPAC name is 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4921284 |
| Molecular Formula | C32H30N3O6+ |
| Molecular Weight | 552.61 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | 4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCC[n+]2cc[nH]c2)C(c2ccc(OCc3ccccc3)cc2)C1=C(O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C32H29N3O6/c36-30(24-9-12-26-27(19-24)40-18-17-39-26)28-29(35(32(38)31(28)37)15-4-14-34-16-13-33-21-34)23-7-10-25(11-8-23)41-20-22-5-2-1-3-6-22/h1-3,5-13,16,19,21,29H,4,14-15,17-18,20H2,(H,36,37)/p+1 |
| InChIKey | OALSLFLWOLZFHU-UHFFFAOYSA-O |
| XLogP | 4.16 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|