C30H36N2O8 — CID 4921928
2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-propoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 4921928) has the molecular formula C30H36N2O8 and a molecular weight of 552.62 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-propoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-propoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 4921928 |
| Molecular Formula | C30H36N2O8 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.25 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-propoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | CCCOc1ccc(C2C(=C([O-])c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CC[NH+]2CCOCC2)cc1OCC |
| InChI | InChI=1S/C30H36N2O8/c1-3-13-38-22-7-5-20(18-24(22)37-4-2)27-26(28(33)21-6-8-23-25(19-21)40-17-16-39-23)29(34)30(35)32(27)10-9-31-11-14-36-15-12-31/h5-8,18-19,27,33H,3-4,9-17H2,1-2H3 |
| InChIKey | QBRROGKFONZWFD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|