C33H42N2O8 — CID 6238563
(E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate (PubChem CID 6238563) has the molecular formula C33H42N2O8 and a molecular weight of 594.71 g/mol. Its IUPAC name is (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate.
| Compound Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
|---|---|
| PubChem CID | 6238563 |
| Molecular Formula | C33H42N2O8 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.29 |
| IUPAC Name | (E)-2,3-dihydro-1,4-benzodioxin-6-yl-[2-(3-ethoxy-4-pentoxyphenyl)-1-(3-morpholin-4-ium-4-ylpropyl)-4,5-dioxopyrrolidin-3-ylidene]methanolate |
| SMILES | CCCCCOc1ccc(C2/C(=C(\[O-])c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCC[NH+]2CCOCC2)cc1OCC |
| InChI | InChI=1S/C33H42N2O8/c1-3-5-6-16-41-25-10-8-23(21-27(25)40-4-2)30-29(31(36)24-9-11-26-28(22-24)43-20-19-42-26)32(37)33(38)35(30)13-7-12-34-14-17-39-18-15-34/h8-11,21-22,30,36H,3-7,12-20H2,1-2H3/b31-29+ |
| InChIKey | ZARMETZRFJQCQZ-OWWNRXNESA-N |
| XLogP | 1.95 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|