C30H37N2O7+ — CID 7829190
(5R)-5-(4-butoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 7829190) has the molecular formula C30H37N2O7+ and a molecular weight of 537.63 g/mol. Its IUPAC name is (5R)-5-(4-butoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(4-butoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 7829190 |
| Molecular Formula | C30H37N2O7+ |
| Molecular Weight | 537.63 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | (5R)-5-(4-butoxyphenyl)-4-[2,3-dihydro-1,4-benzodioxin-6-yl(hydroxy)methylidene]-1-(3-morpholin-4-ium-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CCCCOc1ccc([C@@H]2C(=C(O)c3ccc4c(c3)OCCO4)C(=O)C(=O)N2CCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C30H36N2O7/c1-2-3-15-37-23-8-5-21(6-9-23)27-26(28(33)22-7-10-24-25(20-22)39-19-18-38-24)29(34)30(35)32(27)12-4-11-31-13-16-36-17-14-31/h5-10,20,27,33H,2-4,11-19H2,1H3/p+1/t27-/m1/s1 |
| InChIKey | XXDACQUITRCOIZ-HHHXNRCGSA-O |
| XLogP | 2.36 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.63 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|