C22H26ClN5O — CID 49225752
2-tert-butyl-4-chloro-5-[4-(quinolin-8-ylmethyl)piperazin-1-yl]pyridazin-3-one (PubChem CID 49225752) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5-[4-(quinolin-8-ylmethyl)piperazin-1-yl]pyridazin-3-one.
| Compound Name | 2-tert-butyl-4-chloro-5-[4-(quinolin-8-ylmethyl)piperazin-1-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 49225752 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-tert-butyl-4-chloro-5-[4-(quinolin-8-ylmethyl)piperazin-1-yl]pyridazin-3-one |
| SMILES | CC(C)(C)n1ncc(N2CCN(Cc3cccc4cccnc34)CC2)c(Cl)c1=O |
| InChI | InChI=1S/C22H26ClN5O/c1-22(2,3)28-21(29)19(23)18(14-25-28)27-12-10-26(11-13-27)15-17-7-4-6-16-8-5-9-24-20(16)17/h4-9,14H,10-13,15H2,1-3H3 |
| InChIKey | WFYINSNTDWSMFR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |