C16H22BrN3O5 — CID 49232561
methyl 3-[[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-(2-methylpropyl)amino]propanoate (PubChem CID 49232561) has the molecular formula C16H22BrN3O5 and a molecular weight of 416.27 g/mol. Its IUPAC name is methyl 3-[[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-(2-methylpropyl)amino]propanoate.
| Compound Name | methyl 3-[[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 49232561 |
| Molecular Formula | C16H22BrN3O5 |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | methyl 3-[[2-(2-bromo-4-nitroanilino)-2-oxoethyl]-(2-methylpropyl)amino]propanoate |
| SMILES | COC(=O)CCN(CC(=O)Nc1ccc([N+](=O)[O-])cc1Br)CC(C)C |
| InChI | InChI=1S/C16H22BrN3O5/c1-11(2)9-19(7-6-16(22)25-3)10-15(21)18-14-5-4-12(20(23)24)8-13(14)17/h4-5,8,11H,6-7,9-10H2,1-3H3,(H,18,21) |
| InChIKey | PLVKIRROOWDKDP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|