C17H15N3O4 — CID 4925685
N-[(2-nitrophenyl)methylideneamino]-4-prop-2-enoxybenzamide (PubChem CID 4925685) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methylideneamino]-4-prop-2-enoxybenzamide.
| Compound Name | N-[(2-nitrophenyl)methylideneamino]-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 4925685 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[(2-nitrophenyl)methylideneamino]-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)NN=Cc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15N3O4/c1-2-11-24-15-9-7-13(8-10-15)17(21)19-18-12-14-5-3-4-6-16(14)20(22)23/h2-10,12H,1,11H2,(H,19,21) |
| InChIKey | ZHRZFMQKOALGOX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|