C23H20N4O5S — CID 92648462
4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(Z)-(2-nitrophenyl)methylideneamino]benzamide (PubChem CID 92648462) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(Z)-(2-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(Z)-(2-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 92648462 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 4-[benzenesulfonyl(prop-2-enyl)amino]-N-[(Z)-(2-nitrophenyl)methylideneamino]benzamide |
| SMILES | C=CCN(c1ccc(C(=O)N/N=C\c2ccccc2[N+](=O)[O-])cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20N4O5S/c1-2-16-26(33(31,32)21-9-4-3-5-10-21)20-14-12-18(13-15-20)23(28)25-24-17-19-8-6-7-11-22(19)27(29)30/h2-15,17H,1,16H2,(H,25,28)/b24-17- |
| InChIKey | ZOQSVCNTMJATQD-ULJHMMPZSA-N |
| XLogP | 3.74 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|