C16H25N3O3S — CID 49262524
2-methyl-N-[[3-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboxamide (PubChem CID 49262524) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-methyl-N-[[3-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboxamide.
| Compound Name | 2-methyl-N-[[3-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 49262524 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-methyl-N-[[3-(methylsulfamoylmethyl)phenyl]methyl]piperidine-1-carboxamide |
| SMILES | CNS(=O)(=O)Cc1cccc(CNC(=O)N2CCCCC2C)c1 |
| InChI | InChI=1S/C16H25N3O3S/c1-13-6-3-4-9-19(13)16(20)18-11-14-7-5-8-15(10-14)12-23(21,22)17-2/h5,7-8,10,13,17H,3-4,6,9,11-12H2,1-2H3,(H,18,20) |
| InChIKey | LQSZODKCOLEKCI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |