C14H19F2N3O3S — CID 138049611
(2S)-2-(difluoromethyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 138049611) has the molecular formula C14H19F2N3O3S and a molecular weight of 347.39 g/mol. Its IUPAC name is (2S)-2-(difluoromethyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-(difluoromethyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 138049611 |
| Molecular Formula | C14H19F2N3O3S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (2S)-2-(difluoromethyl)-N-[[3-(methylsulfamoyl)phenyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | CNS(=O)(=O)c1cccc(CNC(=O)N2CCC[C@H]2C(F)F)c1 |
| InChI | InChI=1S/C14H19F2N3O3S/c1-17-23(21,22)11-5-2-4-10(8-11)9-18-14(20)19-7-3-6-12(19)13(15)16/h2,4-5,8,12-13,17H,3,6-7,9H2,1H3,(H,18,20)/t12-/m0/s1 |
| InChIKey | OABZOBFXSJBGRI-LBPRGKRZSA-N |
| XLogP | 1.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |