C17H15FN4O3 — CID 49277736
2-[[4-(cyanomethoxy)phenyl]carbamoylamino]-N-(4-fluorophenyl)acetamide (PubChem CID 49277736) has the molecular formula C17H15FN4O3 and a molecular weight of 342.33 g/mol. Its IUPAC name is 2-[[4-(cyanomethoxy)phenyl]carbamoylamino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[4-(cyanomethoxy)phenyl]carbamoylamino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 49277736 |
| Molecular Formula | C17H15FN4O3 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-[[4-(cyanomethoxy)phenyl]carbamoylamino]-N-(4-fluorophenyl)acetamide |
| SMILES | N#CCOc1ccc(NC(=O)NCC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H15FN4O3/c18-12-1-3-13(4-2-12)21-16(23)11-20-17(24)22-14-5-7-15(8-6-14)25-10-9-19/h1-8H,10-11H2,(H,21,23)(H2,20,22,24) |
| InChIKey | YNNXQYCKTWPSCQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |