C25H25ClN2O3 — CID 4930793
N-benzyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-methylamino]benzamide (PubChem CID 4930793) has the molecular formula C25H25ClN2O3 and a molecular weight of 436.94 g/mol. Its IUPAC name is N-benzyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-methylamino]benzamide.
| Compound Name | N-benzyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-methylamino]benzamide |
|---|---|
| PubChem CID | 4930793 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-benzyl-2-[[2-(4-chloro-3,5-dimethylphenoxy)acetyl]-methylamino]benzamide |
| SMILES | Cc1cc(OCC(=O)N(C)c2ccccc2C(=O)NCc2ccccc2)cc(C)c1Cl |
| InChI | InChI=1S/C25H25ClN2O3/c1-17-13-20(14-18(2)24(17)26)31-16-23(29)28(3)22-12-8-7-11-21(22)25(30)27-15-19-9-5-4-6-10-19/h4-14H,15-16H2,1-3H3,(H,27,30) |
| InChIKey | OEWKNQYGTSPPQH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |