C26H28N2O3 — CID 9297562
N-benzyl-2-[[(2R)-2-(2,6-dimethylphenoxy)propanoyl]-methylamino]benzamide (PubChem CID 9297562) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is N-benzyl-2-[[(2R)-2-(2,6-dimethylphenoxy)propanoyl]-methylamino]benzamide.
| Compound Name | N-benzyl-2-[[(2R)-2-(2,6-dimethylphenoxy)propanoyl]-methylamino]benzamide |
|---|---|
| PubChem CID | 9297562 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N-benzyl-2-[[(2R)-2-(2,6-dimethylphenoxy)propanoyl]-methylamino]benzamide |
| SMILES | Cc1cccc(C)c1O[C@H](C)C(=O)N(C)c1ccccc1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O3/c1-18-11-10-12-19(2)24(18)31-20(3)26(30)28(4)23-16-9-8-15-22(23)25(29)27-17-21-13-6-5-7-14-21/h5-16,20H,17H2,1-4H3,(H,27,29)/t20-/m1/s1 |
| InChIKey | MVQVNFSETCHQID-HXUWFJFHSA-N |
| XLogP | 4.66 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |