C10H17N3OS2 — CID 49314040
1-(3-ethoxypropyl)-3-(1,3-thiazol-4-ylmethyl)thiourea (PubChem CID 49314040) has the molecular formula C10H17N3OS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-(1,3-thiazol-4-ylmethyl)thiourea.
| Compound Name | 1-(3-ethoxypropyl)-3-(1,3-thiazol-4-ylmethyl)thiourea |
|---|---|
| PubChem CID | 49314040 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-(1,3-thiazol-4-ylmethyl)thiourea |
| SMILES | CCOCCCNC(=S)NCc1cscn1 |
| InChI | InChI=1S/C10H17N3OS2/c1-2-14-5-3-4-11-10(15)12-6-9-7-16-8-13-9/h7-8H,2-6H2,1H3,(H2,11,12,15) |
| InChIKey | LRVWPPDSCBPOLT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|