C20H19N3O3S2 — CID 49321309
ethyl 2-[benzyl-[(E)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 49321309) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is ethyl 2-[benzyl-[(E)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[benzyl-[(E)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 49321309 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | ethyl 2-[benzyl-[(E)-3-(1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N(Cc2ccccc2)C(=O)/C=C/c2cscn2)nc1C |
| InChI | InChI=1S/C20H19N3O3S2/c1-3-26-19(25)18-14(2)22-20(28-18)23(11-15-7-5-4-6-8-15)17(24)10-9-16-12-27-13-21-16/h4-10,12-13H,3,11H2,1-2H3/b10-9+ |
| InChIKey | OLWDKRLNNISMOA-MDZDMXLPSA-N |
| XLogP | 4.33 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|