C18H14F2N4O4 — CID 49336590
N-[[3-(difluoromethoxy)phenyl]methyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 49336590) has the molecular formula C18H14F2N4O4 and a molecular weight of 388.33 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)phenyl]methyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | N-[[3-(difluoromethoxy)phenyl]methyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 49336590 |
| Molecular Formula | C18H14F2N4O4 |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[[3-(difluoromethoxy)phenyl]methyl]-1-(3-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)F)c1)c1ccn(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C18H14F2N4O4/c19-18(20)28-15-6-1-3-12(9-15)11-21-17(25)16-7-8-23(22-16)13-4-2-5-14(10-13)24(26)27/h1-10,18H,11H2,(H,21,25) |
| InChIKey | VVNYJSPKNUTLNU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|