C21H21N5O3 — CID 55678999
1-(3-nitrophenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrazole-3-carboxamide (PubChem CID 55678999) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | 1-(3-nitrophenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55678999 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-(3-nitrophenyl)-N-[(1-phenylpyrrolidin-3-yl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NCC1CCN(c2ccccc2)C1)c1ccn(-c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C21H21N5O3/c27-21(22-14-16-9-11-24(15-16)17-5-2-1-3-6-17)20-10-12-25(23-20)18-7-4-8-19(13-18)26(28)29/h1-8,10,12-13,16H,9,11,14-15H2,(H,22,27) |
| InChIKey | JLBJCSOQNRANTI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|