C27H24N2O3 — CID 4937337
N-benzyl-N-methyl-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide (PubChem CID 4937337) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-benzyl-N-methyl-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide.
| Compound Name | N-benzyl-N-methyl-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide |
|---|---|
| PubChem CID | 4937337 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-benzyl-N-methyl-2-[(2-naphthalen-2-yloxyacetyl)amino]benzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccccc1NC(=O)COc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H24N2O3/c1-29(18-20-9-3-2-4-10-20)27(31)24-13-7-8-14-25(24)28-26(30)19-32-23-16-15-21-11-5-6-12-22(21)17-23/h2-17H,18-19H2,1H3,(H,28,30) |
| InChIKey | WIVUZLGVDNKTCS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |