C14H18N2O4S — CID 49418686
4-[3-(methylsulfinylmethyl)benzoyl]morpholine-2-carboxamide (PubChem CID 49418686) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-[3-(methylsulfinylmethyl)benzoyl]morpholine-2-carboxamide.
| Compound Name | 4-[3-(methylsulfinylmethyl)benzoyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 49418686 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-[3-(methylsulfinylmethyl)benzoyl]morpholine-2-carboxamide |
| SMILES | CS(=O)Cc1cccc(C(=O)N2CCOC(C(N)=O)C2)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-21(19)9-10-3-2-4-11(7-10)14(18)16-5-6-20-12(8-16)13(15)17/h2-4,7,12H,5-6,8-9H2,1H3,(H2,15,17) |
| InChIKey | CMENWFMTSUPFIQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |