C12H13BrN2O2S — CID 79674488
4-(3-bromobenzoyl)morpholine-2-carbothioamide (PubChem CID 79674488) has the molecular formula C12H13BrN2O2S and a molecular weight of 329.22 g/mol. Its IUPAC name is 4-(3-bromobenzoyl)morpholine-2-carbothioamide.
| Compound Name | 4-(3-bromobenzoyl)morpholine-2-carbothioamide |
|---|---|
| PubChem CID | 79674488 |
| Molecular Formula | C12H13BrN2O2S |
| Molecular Weight | 329.22 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 4-(3-bromobenzoyl)morpholine-2-carbothioamide |
| SMILES | NC(=S)C1CN(C(=O)c2cccc(Br)c2)CCO1 |
| InChI | InChI=1S/C12H13BrN2O2S/c13-9-3-1-2-8(6-9)12(16)15-4-5-17-10(7-15)11(14)18/h1-3,6,10H,4-5,7H2,(H2,14,18) |
| InChIKey | PKZBEIGXFMYXPG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|