C10H14N4O2S — CID 79674149
4-(1-methylpyrazole-4-carbonyl)morpholine-2-carbothioamide (PubChem CID 79674149) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 4-(1-methylpyrazole-4-carbonyl)morpholine-2-carbothioamide.
| Compound Name | 4-(1-methylpyrazole-4-carbonyl)morpholine-2-carbothioamide |
|---|---|
| PubChem CID | 79674149 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 4-(1-methylpyrazole-4-carbonyl)morpholine-2-carbothioamide |
| SMILES | Cn1cc(C(=O)N2CCOC(C(N)=S)C2)cn1 |
| InChI | InChI=1S/C10H14N4O2S/c1-13-5-7(4-12-13)10(15)14-2-3-16-8(6-14)9(11)17/h4-5,8H,2-3,6H2,1H3,(H2,11,17) |
| InChIKey | FSSOZECUHRIEHP-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|