C20H22ClN3O4S — CID 4942754
N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-hexoxybenzamide (PubChem CID 4942754) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-hexoxybenzamide.
| Compound Name | N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 4942754 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | N-[(2-chloro-4-nitrophenyl)carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H22ClN3O4S/c1-2-3-4-7-12-28-18-9-6-5-8-15(18)19(25)23-20(29)22-17-11-10-14(24(26)27)13-16(17)21/h5-6,8-11,13H,2-4,7,12H2,1H3,(H2,22,23,25,29) |
| InChIKey | BJLZZBDXXSWEJJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|