C24H30N4O4S — CID 4944758
N-[[[4-(benzylamino)-4-oxobutanoyl]amino]carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 4944758) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-[[[4-(benzylamino)-4-oxobutanoyl]amino]carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | N-[[[4-(benzylamino)-4-oxobutanoyl]amino]carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4944758 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-[[[4-(benzylamino)-4-oxobutanoyl]amino]carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccccc1C(=O)NC(=S)NNC(=O)CCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C24H30N4O4S/c1-17(2)14-15-32-20-11-7-6-10-19(20)23(31)26-24(33)28-27-22(30)13-12-21(29)25-16-18-8-4-3-5-9-18/h3-11,17H,12-16H2,1-2H3,(H,25,29)(H,27,30)(H2,26,28,31,33) |
| InChIKey | MGFBTZKKDJQLJQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|