C21H30N2O2S — CID 4949065
N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 4949065) has the molecular formula C21H30N2O2S and a molecular weight of 374.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 4949065 |
| Molecular Formula | C21H30N2O2S |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C21H30N2O2S/c1-16(2)13-15-25-19-10-8-18(9-11-19)20(24)23-21(26)22-14-12-17-6-4-3-5-7-17/h6,8-11,16H,3-5,7,12-15H2,1-2H3,(H2,22,23,24,26) |
| InChIKey | MIVZHOJYCOLNHB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|