C21H24N2O4 — CID 4953506
N'-[2-(4-ethylphenoxy)propanoyl]-4-prop-2-enoxybenzohydrazide (PubChem CID 4953506) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is N'-[2-(4-ethylphenoxy)propanoyl]-4-prop-2-enoxybenzohydrazide.
| Compound Name | N'-[2-(4-ethylphenoxy)propanoyl]-4-prop-2-enoxybenzohydrazide |
|---|---|
| PubChem CID | 4953506 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | N'-[2-(4-ethylphenoxy)propanoyl]-4-prop-2-enoxybenzohydrazide |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)C(C)Oc2ccc(CC)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O4/c1-4-14-26-18-12-8-17(9-13-18)21(25)23-22-20(24)15(3)27-19-10-6-16(5-2)7-11-19/h4,6-13,15H,1,5,14H2,2-3H3,(H,22,24)(H,23,25) |
| InChIKey | BMSFHENIPMBGJK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|