C19H21IN2O4 — CID 4953445
N'-[2-(4-ethylphenoxy)propanoyl]-3-iodo-4-methoxybenzohydrazide (PubChem CID 4953445) has the molecular formula C19H21IN2O4 and a molecular weight of 468.29 g/mol. Its IUPAC name is N'-[2-(4-ethylphenoxy)propanoyl]-3-iodo-4-methoxybenzohydrazide.
| Compound Name | N'-[2-(4-ethylphenoxy)propanoyl]-3-iodo-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 4953445 |
| Molecular Formula | C19H21IN2O4 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N'-[2-(4-ethylphenoxy)propanoyl]-3-iodo-4-methoxybenzohydrazide |
| SMILES | CCc1ccc(OC(C)C(=O)NNC(=O)c2ccc(OC)c(I)c2)cc1 |
| InChI | InChI=1S/C19H21IN2O4/c1-4-13-5-8-15(9-6-13)26-12(2)18(23)21-22-19(24)14-7-10-17(25-3)16(20)11-14/h5-12H,4H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | HYLFOSMTXKMMTQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|