C21H20N4O — CID 4963076
2-(4,6-dimethylpyrimidin-2-yl)-3,5-diphenyl-4H-pyrazol-3-ol (PubChem CID 4963076) has the molecular formula C21H20N4O and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-(4,6-dimethylpyrimidin-2-yl)-3,5-diphenyl-4H-pyrazol-3-ol.
| Compound Name | 2-(4,6-dimethylpyrimidin-2-yl)-3,5-diphenyl-4H-pyrazol-3-ol |
|---|---|
| PubChem CID | 4963076 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-(4,6-dimethylpyrimidin-2-yl)-3,5-diphenyl-4H-pyrazol-3-ol |
| SMILES | Cc1cc(C)nc(N2N=C(c3ccccc3)CC2(O)c2ccccc2)n1 |
| InChI | InChI=1S/C21H20N4O/c1-15-13-16(2)23-20(22-15)25-21(26,18-11-7-4-8-12-18)14-19(24-25)17-9-5-3-6-10-17/h3-13,26H,14H2,1-2H3 |
| InChIKey | IUXZTBLZCKDTBV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |