C18H22N4O3 — CID 4963609
3-[2-(cycloheptylamino)-2-oxoethyl]-4-oxophthalazine-1-carboxamide (PubChem CID 4963609) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 3-[2-(cycloheptylamino)-2-oxoethyl]-4-oxophthalazine-1-carboxamide.
| Compound Name | 3-[2-(cycloheptylamino)-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 4963609 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 3-[2-(cycloheptylamino)-2-oxoethyl]-4-oxophthalazine-1-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)NC2CCCCCC2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C18H22N4O3/c19-17(24)16-13-9-5-6-10-14(13)18(25)22(21-16)11-15(23)20-12-7-3-1-2-4-8-12/h5-6,9-10,12H,1-4,7-8,11H2,(H2,19,24)(H,20,23) |
| InChIKey | FKDVDWHLWPFRKV-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |