About [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate (PubChem CID 4963750) has the molecular formula C23H28N2O4
and a molecular weight of 396.49 g/mol. Its IUPAC name is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate.
Molecular Properties
| Compound Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate |
| PubChem CID | 4963750 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OC(C)C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-3-28-21-11-9-20(10-12-21)23(27)29-18(2)22(26)25-15-13-24(14-16-25)17-19-7-5-4-6-8-19/h4-12,18H,3,13-17H2,1-2H3 |
| InChIKey | LJQMTFWGNXMGHH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate?
The IUPAC name of [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate (CID 4963750) is [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate.
What is the SMILES notation for [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate?
The canonical SMILES for [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate is CCOc1ccc(C(=O)OC(C)C(=O)N2CCN(Cc3ccccc3)CC2)cc1.
What is the InChIKey of [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate?
The InChIKey is LJQMTFWGNXMGHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O4/c1-3-28-21-11-9-20(10-12-21)23(27)29-18(2)22(26)25-15-13-24(14-16-25)17-19-7-5-4-6-8-19/h4-12,18H,3,13-17H2,1-2H3.
What are the key properties of [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate?
[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate has a molecular weight of 396.49 g/mol, XLogP of 2.97, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl] 4-ethoxybenzoate is sourced from PubChem (CID 4963750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).