C31H27NO7 — CID 4964986
methyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate (PubChem CID 4964986) has the molecular formula C31H27NO7 and a molecular weight of 525.56 g/mol. Its IUPAC name is methyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate.
| Compound Name | methyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 4964986 |
| Molecular Formula | C31H27NO7 |
| Molecular Weight | 525.56 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | methyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c(-c2ccccc2)c(-c2ccc(OC)c(OC)c2)c2c3cc(OC)c(OC)cc3ccn12 |
| InChI | InChI=1S/C31H27NO7/c1-35-22-12-11-20(16-23(22)36-2)27-26(18-9-7-6-8-10-18)29(30(33)31(34)39-5)32-14-13-19-15-24(37-3)25(38-4)17-21(19)28(27)32/h6-17H,1-5H3 |
| InChIKey | SPROZNQIYGDBTP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|