C28H32N2O3 — CID 4966635
2-ethyl-4-[(4-hexoxyphenyl)methylidene]-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid (PubChem CID 4966635) has the molecular formula C28H32N2O3 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-ethyl-4-[(4-hexoxyphenyl)methylidene]-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid.
| Compound Name | 2-ethyl-4-[(4-hexoxyphenyl)methylidene]-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid |
|---|---|
| PubChem CID | 4966635 |
| Molecular Formula | C28H32N2O3 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | 2-ethyl-4-[(4-hexoxyphenyl)methylidene]-1,3-dihydrobenzo[b][1,6]naphthyridine-10-carboxylic acid |
| SMILES | CCCCCCOc1ccc(C=C2CN(CC)Cc3c2nc2ccccc2c3C(=O)O)cc1 |
| InChI | InChI=1S/C28H32N2O3/c1-3-5-6-9-16-33-22-14-12-20(13-15-22)17-21-18-30(4-2)19-24-26(28(31)32)23-10-7-8-11-25(23)29-27(21)24/h7-8,10-15,17H,3-6,9,16,18-19H2,1-2H3,(H,31,32) |
| InChIKey | VGKKMHHOVDFQDO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|