C19H21ClN4O6 — CID 4967870
2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(4-methoxy-2-nitrophenyl)acetamide (PubChem CID 4967870) has the molecular formula C19H21ClN4O6 and a molecular weight of 436.85 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(4-methoxy-2-nitrophenyl)acetamide.
| Compound Name | 2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(4-methoxy-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4967870 |
| Molecular Formula | C19H21ClN4O6 |
| Molecular Weight | 436.85 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-methylamino]-N-(4-methoxy-2-nitrophenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CN(C)CC(=O)Nc2cc(Cl)ccc2OC)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21ClN4O6/c1-23(11-19(26)22-15-8-12(20)4-7-17(15)30-3)10-18(25)21-14-6-5-13(29-2)9-16(14)24(27)28/h4-9H,10-11H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | NPCILYOGYQFVHR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.85 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|