C12H12BrNO5S — CID 4969700
2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylbutanedioic acid (PubChem CID 4969700) has the molecular formula C12H12BrNO5S and a molecular weight of 362.20 g/mol. Its IUPAC name is 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylbutanedioic acid.
| Compound Name | 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylbutanedioic acid |
|---|---|
| PubChem CID | 4969700 |
| Molecular Formula | C12H12BrNO5S |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 2-[2-(4-bromoanilino)-2-oxoethyl]sulfanylbutanedioic acid |
| SMILES | O=C(O)CC(SCC(=O)Nc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C12H12BrNO5S/c13-7-1-3-8(4-2-7)14-10(15)6-20-9(12(18)19)5-11(16)17/h1-4,9H,5-6H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | ZHNSKKAECWOWAJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |