C20H19ClN2O2 — CID 4969773
3-(4-chlorophenyl)-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]propanamide (PubChem CID 4969773) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 4969773 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 3-(4-chlorophenyl)-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]propanamide |
| SMILES | CN(Cc1cc(=O)[nH]c2ccccc12)C(=O)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-23(20(25)11-8-14-6-9-16(21)10-7-14)13-15-12-19(24)22-18-5-3-2-4-17(15)18/h2-7,9-10,12H,8,11,13H2,1H3,(H,22,24) |
| InChIKey | JSTPFJZTAHGWKQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |