C16H15N3O4S — CID 7555926
2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]acetamide (PubChem CID 7555926) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]acetamide.
| Compound Name | 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 7555926 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[(5R)-2,4-dioxo-1,3-thiazolidin-5-yl]-N-methyl-N-[(2-oxo-1H-quinolin-4-yl)methyl]acetamide |
| SMILES | CN(Cc1cc(=O)[nH]c2ccccc12)C(=O)C[C@H]1SC(=O)NC1=O |
| InChI | InChI=1S/C16H15N3O4S/c1-19(14(21)7-12-15(22)18-16(23)24-12)8-9-6-13(20)17-11-5-3-2-4-10(9)11/h2-6,12H,7-8H2,1H3,(H,17,20)(H,18,22,23)/t12-/m1/s1 |
| InChIKey | NBRIJELLFJSJHR-GFCCVEGCSA-N |
| XLogP | 1.23 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|