C17H15FN4O2S2 — CID 4971615
2-[5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide (PubChem CID 4971615) has the molecular formula C17H15FN4O2S2 and a molecular weight of 390.47 g/mol. Its IUPAC name is 2-[5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide.
| Compound Name | 2-[5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 4971615 |
| Molecular Formula | C17H15FN4O2S2 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-[5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)C(=Cc2cccc(F)c2)SC1=S)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C17H15FN4O2S2/c18-12-3-1-2-11(6-12)7-14-16(24)22(17(25)26-14)9-15(23)20-5-4-13-8-19-10-21-13/h1-3,6-8,10H,4-5,9H2,(H,19,21)(H,20,23) |
| InChIKey | DLRGFUFQNGANIA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|