C19H19ClN4O2S2 — CID 4893381
4-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]butanamide (PubChem CID 4893381) has the molecular formula C19H19ClN4O2S2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 4-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]butanamide.
| Compound Name | 4-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]butanamide |
|---|---|
| PubChem CID | 4893381 |
| Molecular Formula | C19H19ClN4O2S2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 4-[5-[(4-chlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-[2-(1H-imidazol-5-yl)ethyl]butanamide |
| SMILES | O=C(CCCN1C(=O)C(=Cc2ccc(Cl)cc2)SC1=S)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C19H19ClN4O2S2/c20-14-5-3-13(4-6-14)10-16-18(26)24(19(27)28-16)9-1-2-17(25)22-8-7-15-11-21-12-23-15/h3-6,10-12H,1-2,7-9H2,(H,21,23)(H,22,25) |
| InChIKey | GAASJEDXPJHWIK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|