C17H20N6 — CID 4974193
7-ethyl-5-N-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine-1,5-diamine (PubChem CID 4974193) has the molecular formula C17H20N6 and a molecular weight of 308.39 g/mol. Its IUPAC name is 7-ethyl-5-N-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine-1,5-diamine.
| Compound Name | 7-ethyl-5-N-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine-1,5-diamine |
|---|---|
| PubChem CID | 4974193 |
| Molecular Formula | C17H20N6 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 7-ethyl-5-N-phenyl-2,6,8,9-tetrahydropyrazolo[3,4-c][2,7]naphthyridine-1,5-diamine |
| SMILES | CCN1CCc2c(c(Nc3ccccc3)nc3n[nH]c(N)c23)C1 |
| InChI | InChI=1S/C17H20N6/c1-2-23-9-8-12-13(10-23)16(19-11-6-4-3-5-7-11)20-17-14(12)15(18)21-22-17/h3-7H,2,8-10H2,1H3,(H4,18,19,20,21,22) |
| InChIKey | IUXJRJDOGPMEEG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |