C19H17ClF3NO4S — CID 4976241
8-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline (PubChem CID 4976241) has the molecular formula C19H17ClF3NO4S and a molecular weight of 447.86 g/mol. Its IUPAC name is 8-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline.
| Compound Name | 8-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 4976241 |
| Molecular Formula | C19H17ClF3NO4S |
| Molecular Weight | 447.86 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | 8-[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
| SMILES | O=S(=O)(c1ccc(Cl)c(C(F)(F)F)c1)N1CCc2cc3c(cc2C1)OCCCO3 |
| InChI | InChI=1S/C19H17ClF3NO4S/c20-16-3-2-14(10-15(16)19(21,22)23)29(25,26)24-5-4-12-8-17-18(9-13(12)11-24)28-7-1-6-27-17/h2-3,8-10H,1,4-7,11H2 |
| InChIKey | QYROZUPTOHFISB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |