C15H12Cl2N2O4S — CID 110616106
6-[(5,6-dichloro-3-pyridinyl)sulfonyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline (PubChem CID 110616106) has the molecular formula C15H12Cl2N2O4S and a molecular weight of 387.24 g/mol. Its IUPAC name is 6-[(5,6-dichloro-3-pyridinyl)sulfonyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline.
| Compound Name | 6-[(5,6-dichloro-3-pyridinyl)sulfonyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline |
|---|---|
| PubChem CID | 110616106 |
| Molecular Formula | C15H12Cl2N2O4S |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | 6-[(5,6-dichloro-3-pyridinyl)sulfonyl]-7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinoline |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N1CCc2cc3c(cc2C1)OCO3 |
| InChI | InChI=1S/C15H12Cl2N2O4S/c16-12-5-11(6-18-15(12)17)24(20,21)19-2-1-9-3-13-14(23-8-22-13)4-10(9)7-19/h3-6H,1-2,7-8H2 |
| InChIKey | AWWLOOYTYHPPEH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|