C28H31N4O4+ — CID 4977029
5-[4-(dimethylamino)phenyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione (PubChem CID 4977029) has the molecular formula C28H31N4O4+ and a molecular weight of 487.58 g/mol. Its IUPAC name is 5-[4-(dimethylamino)phenyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione.
| Compound Name | 5-[4-(dimethylamino)phenyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4977029 |
| Molecular Formula | C28H31N4O4+ |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 5-[4-(dimethylamino)phenyl]-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-[3-(1H-imidazol-3-ium-3-yl)propyl]pyrrolidine-2,3-dione |
| SMILES | CC1Cc2cc(C(O)=C3C(=O)C(=O)N(CCC[n+]4cc[nH]c4)C3c3ccc(N(C)C)cc3)ccc2O1 |
| InChI | InChI=1S/C28H30N4O4/c1-18-15-21-16-20(7-10-23(21)36-18)26(33)24-25(19-5-8-22(9-6-19)30(2)3)32(28(35)27(24)34)13-4-12-31-14-11-29-17-31/h5-11,14,16-18,25H,4,12-13,15H2,1-3H3,(H,33,34)/p+1 |
| InChIKey | RWEFZDGERVAKKD-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|