C26H24FN3O4 — CID 3606632
[2-(4-fluorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate (PubChem CID 3606632) has the molecular formula C26H24FN3O4 and a molecular weight of 461.49 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate.
| Compound Name | [2-(4-fluorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
|---|---|
| PubChem CID | 3606632 |
| Molecular Formula | C26H24FN3O4 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [2-(4-fluorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
| SMILES | CC1Cc2cc(C([O-])=C3C(=O)C(=O)N(CCC[n+]4cc[nH]c4)C3c3ccc(F)cc3)ccc2O1 |
| InChI | InChI=1S/C26H24FN3O4/c1-16-13-19-14-18(5-8-21(19)34-16)24(31)22-23(17-3-6-20(27)7-4-17)30(26(33)25(22)32)11-2-10-29-12-9-28-15-29/h3-9,12,14-16,23H,2,10-11,13H2,1H3,(H,31,32) |
| InChIKey | KRTNDKFOZSSMNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|