C26H23Cl2N3O4 — CID 4978334
[2-(3,4-dichlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate (PubChem CID 4978334) has the molecular formula C26H23Cl2N3O4 and a molecular weight of 512.39 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate.
| Compound Name | [2-(3,4-dichlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
|---|---|
| PubChem CID | 4978334 |
| Molecular Formula | C26H23Cl2N3O4 |
| Molecular Weight | 512.39 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxopyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
| SMILES | CC1Cc2cc(C([O-])=C3C(=O)C(=O)N(CCC[n+]4cc[nH]c4)C3c3ccc(Cl)c(Cl)c3)ccc2O1 |
| InChI | InChI=1S/C26H23Cl2N3O4/c1-15-11-18-12-17(4-6-21(18)35-15)24(32)22-23(16-3-5-19(27)20(28)13-16)31(26(34)25(22)33)9-2-8-30-10-7-29-14-30/h3-7,10,12-15,23H,2,8-9,11H2,1H3,(H,32,33) |
| InChIKey | RCEDOZYEZUFYSG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|