C31H35N3O5 — CID 4921246
[1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxo-2-(3-pentoxyphenyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate (PubChem CID 4921246) has the molecular formula C31H35N3O5 and a molecular weight of 529.64 g/mol. Its IUPAC name is [1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxo-2-(3-pentoxyphenyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate.
| Compound Name | [1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxo-2-(3-pentoxyphenyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
|---|---|
| PubChem CID | 4921246 |
| Molecular Formula | C31H35N3O5 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | [1-[3-(1H-imidazol-3-ium-3-yl)propyl]-4,5-dioxo-2-(3-pentoxyphenyl)pyrrolidin-3-ylidene]-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methanolate |
| SMILES | CCCCCOc1cccc(C2C(=C([O-])c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2CCC[n+]2cc[nH]c2)c1 |
| InChI | InChI=1S/C31H35N3O5/c1-3-4-5-16-38-25-9-6-8-22(19-25)28-27(29(35)23-10-11-26-24(18-23)17-21(2)39-26)30(36)31(37)34(28)14-7-13-33-15-12-32-20-33/h6,8-12,15,18-21,28H,3-5,7,13-14,16-17H2,1-2H3,(H,35,36) |
| InChIKey | KPQJNNRSDZIYJW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|